C18H21N3O7 — CID 56520701
ethyl 4-(2-butoxy-2-oxoethoxy)-1-(4-nitrophenyl)pyrazole-3-carboxylate (PubChem CID 56520701) has the molecular formula C18H21N3O7 and a molecular weight of 391.38 g/mol. Its IUPAC name is ethyl 4-(2-butoxy-2-oxoethoxy)-1-(4-nitrophenyl)pyrazole-3-carboxylate.
| Compound Name | ethyl 4-(2-butoxy-2-oxoethoxy)-1-(4-nitrophenyl)pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 56520701 |
| Molecular Formula | C18H21N3O7 |
| Molecular Weight | 391.38 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | ethyl 4-(2-butoxy-2-oxoethoxy)-1-(4-nitrophenyl)pyrazole-3-carboxylate |
| SMILES | CCCCOC(=O)COc1cn(-c2ccc([N+](=O)[O-])cc2)nc1C(=O)OCC |
| InChI | InChI=1S/C18H21N3O7/c1-3-5-10-27-16(22)12-28-15-11-20(19-17(15)18(23)26-4-2)13-6-8-14(9-7-13)21(24)25/h6-9,11H,3-5,10,12H2,1-2H3 |
| InChIKey | SEOSSVJAWNBCDK-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 122.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.38 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|