C22H21ClN4O6 — CID 55753328
ethyl 4-[2-[1-(2-chlorophenyl)ethylamino]-2-oxoethoxy]-1-(4-nitrophenyl)pyrazole-3-carboxylate (PubChem CID 55753328) has the molecular formula C22H21ClN4O6 and a molecular weight of 472.89 g/mol. Its IUPAC name is ethyl 4-[2-[1-(2-chlorophenyl)ethylamino]-2-oxoethoxy]-1-(4-nitrophenyl)pyrazole-3-carboxylate.
| Compound Name | ethyl 4-[2-[1-(2-chlorophenyl)ethylamino]-2-oxoethoxy]-1-(4-nitrophenyl)pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 55753328 |
| Molecular Formula | C22H21ClN4O6 |
| Molecular Weight | 472.89 g/mol |
| Exact Mass | 472.11 |
| IUPAC Name | ethyl 4-[2-[1-(2-chlorophenyl)ethylamino]-2-oxoethoxy]-1-(4-nitrophenyl)pyrazole-3-carboxylate |
| SMILES | CCOC(=O)c1nn(-c2ccc([N+](=O)[O-])cc2)cc1OCC(=O)NC(C)c1ccccc1Cl |
| InChI | InChI=1S/C22H21ClN4O6/c1-3-32-22(29)21-19(12-26(25-21)15-8-10-16(11-9-15)27(30)31)33-13-20(28)24-14(2)17-6-4-5-7-18(17)23/h4-12,14H,3,13H2,1-2H3,(H,24,28) |
| InChIKey | FDBAYGJRWPXKBM-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 125.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.89 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|