C22H29N5O7 — CID 46484268
ethyl 4-[2-[(2-methyl-2-morpholin-4-ylpropyl)amino]-2-oxoethoxy]-1-(4-nitrophenyl)pyrazole-3-carboxylate (PubChem CID 46484268) has the molecular formula C22H29N5O7 and a molecular weight of 475.50 g/mol. Its IUPAC name is ethyl 4-[2-[(2-methyl-2-morpholin-4-ylpropyl)amino]-2-oxoethoxy]-1-(4-nitrophenyl)pyrazole-3-carboxylate.
| Compound Name | ethyl 4-[2-[(2-methyl-2-morpholin-4-ylpropyl)amino]-2-oxoethoxy]-1-(4-nitrophenyl)pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 46484268 |
| Molecular Formula | C22H29N5O7 |
| Molecular Weight | 475.50 g/mol |
| Exact Mass | 475.21 |
| IUPAC Name | ethyl 4-[2-[(2-methyl-2-morpholin-4-ylpropyl)amino]-2-oxoethoxy]-1-(4-nitrophenyl)pyrazole-3-carboxylate |
| SMILES | CCOC(=O)c1nn(-c2ccc([N+](=O)[O-])cc2)cc1OCC(=O)NCC(C)(C)N1CCOCC1 |
| InChI | InChI=1S/C22H29N5O7/c1-4-33-21(29)20-18(13-26(24-20)16-5-7-17(8-6-16)27(30)31)34-14-19(28)23-15-22(2,3)25-9-11-32-12-10-25/h5-8,13H,4,9-12,14-15H2,1-3H3,(H,23,28) |
| InChIKey | LYJREGAIGCEUEE-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 138.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.50 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|