C22H23N7O6 — CID 46484270
ethyl 1-(4-nitrophenyl)-4-[2-oxo-2-(4-pyrimidin-2-ylpiperazin-1-yl)ethoxy]pyrazole-3-carboxylate (PubChem CID 46484270) has the molecular formula C22H23N7O6 and a molecular weight of 481.47 g/mol. Its IUPAC name is ethyl 1-(4-nitrophenyl)-4-[2-oxo-2-(4-pyrimidin-2-ylpiperazin-1-yl)ethoxy]pyrazole-3-carboxylate.
| Compound Name | ethyl 1-(4-nitrophenyl)-4-[2-oxo-2-(4-pyrimidin-2-ylpiperazin-1-yl)ethoxy]pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 46484270 |
| Molecular Formula | C22H23N7O6 |
| Molecular Weight | 481.47 g/mol |
| Exact Mass | 481.17 |
| IUPAC Name | ethyl 1-(4-nitrophenyl)-4-[2-oxo-2-(4-pyrimidin-2-ylpiperazin-1-yl)ethoxy]pyrazole-3-carboxylate |
| SMILES | CCOC(=O)c1nn(-c2ccc([N+](=O)[O-])cc2)cc1OCC(=O)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C22H23N7O6/c1-2-34-21(31)20-18(14-28(25-20)16-4-6-17(7-5-16)29(32)33)35-15-19(30)26-10-12-27(13-11-26)22-23-8-3-9-24-22/h3-9,14H,2,10-13,15H2,1H3 |
| InChIKey | SYWRUSBNZKFHFM-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 145.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.47 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|