C21H23N5O8 — CID 55753678
ethyl 6-[[3-ethoxycarbonyl-1-(4-nitrophenyl)pyrazol-4-yl]oxymethyl]-4-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 55753678) has the molecular formula C21H23N5O8 and a molecular weight of 473.44 g/mol. Its IUPAC name is ethyl 6-[[3-ethoxycarbonyl-1-(4-nitrophenyl)pyrazol-4-yl]oxymethyl]-4-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | ethyl 6-[[3-ethoxycarbonyl-1-(4-nitrophenyl)pyrazol-4-yl]oxymethyl]-4-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 55753678 |
| Molecular Formula | C21H23N5O8 |
| Molecular Weight | 473.44 g/mol |
| Exact Mass | 473.15 |
| IUPAC Name | ethyl 6-[[3-ethoxycarbonyl-1-(4-nitrophenyl)pyrazol-4-yl]oxymethyl]-4-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(COc2cn(-c3ccc([N+](=O)[O-])cc3)nc2C(=O)OCC)NC(=O)NC1C |
| InChI | InChI=1S/C21H23N5O8/c1-4-32-19(27)17-12(3)22-21(29)23-15(17)11-34-16-10-25(24-18(16)20(28)33-5-2)13-6-8-14(9-7-13)26(30)31/h6-10,12H,4-5,11H2,1-3H3,(H2,22,23,29) |
| InChIKey | ALHRIMWULBIRQV-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 163.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.44 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|