C16H19N3O4 — CID 134143237
ethyl 3-(2-methylpropyl)-1-(4-nitrophenyl)pyrazole-4-carboxylate (PubChem CID 134143237) has the molecular formula C16H19N3O4 and a molecular weight of 317.35 g/mol. Its IUPAC name is ethyl 3-(2-methylpropyl)-1-(4-nitrophenyl)pyrazole-4-carboxylate.
| Compound Name | ethyl 3-(2-methylpropyl)-1-(4-nitrophenyl)pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 134143237 |
| Molecular Formula | C16H19N3O4 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | ethyl 3-(2-methylpropyl)-1-(4-nitrophenyl)pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cn(-c2ccc([N+](=O)[O-])cc2)nc1CC(C)C |
| InChI | InChI=1S/C16H19N3O4/c1-4-23-16(20)14-10-18(17-15(14)9-11(2)3)12-5-7-13(8-6-12)19(21)22/h5-8,10-11H,4,9H2,1-3H3 |
| InChIKey | KCPHJIMDQUPAEP-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 87.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|