C13H11ClN4O6 — CID 11485026
ethyl 3-(chloromethyl)-1-(2,4-dinitrophenyl)pyrazole-4-carboxylate (PubChem CID 11485026) has the molecular formula C13H11ClN4O6 and a molecular weight of 354.71 g/mol. Its IUPAC name is ethyl 3-(chloromethyl)-1-(2,4-dinitrophenyl)pyrazole-4-carboxylate.
| Compound Name | ethyl 3-(chloromethyl)-1-(2,4-dinitrophenyl)pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 11485026 |
| Molecular Formula | C13H11ClN4O6 |
| Molecular Weight | 354.71 g/mol |
| Exact Mass | 354.04 |
| IUPAC Name | ethyl 3-(chloromethyl)-1-(2,4-dinitrophenyl)pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cn(-c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])nc1CCl |
| InChI | InChI=1S/C13H11ClN4O6/c1-2-24-13(19)9-7-16(15-10(9)6-14)11-4-3-8(17(20)21)5-12(11)18(22)23/h3-5,7H,2,6H2,1H3 |
| InChIKey | BRRLSRYRUUBHEJ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 130.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.71 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|