C9H5ClN6O6 — CID 5065708
4-(chloromethyl)-2-(2,4-dinitrophenyl)-5-nitrotriazole (PubChem CID 5065708) has the molecular formula C9H5ClN6O6 and a molecular weight of 328.63 g/mol. Its IUPAC name is 4-(chloromethyl)-2-(2,4-dinitrophenyl)-5-nitrotriazole.
| Compound Name | 4-(chloromethyl)-2-(2,4-dinitrophenyl)-5-nitrotriazole |
|---|---|
| PubChem CID | 5065708 |
| Molecular Formula | C9H5ClN6O6 |
| Molecular Weight | 328.63 g/mol |
| Exact Mass | 328.00 |
| IUPAC Name | 4-(chloromethyl)-2-(2,4-dinitrophenyl)-5-nitrotriazole |
| SMILES | O=[N+]([O-])c1ccc(-n2nc(CCl)c([N+](=O)[O-])n2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C9H5ClN6O6/c10-4-6-9(16(21)22)12-13(11-6)7-2-1-5(14(17)18)3-8(7)15(19)20/h1-3H,4H2 |
| InChIKey | IKOUZDIMTMKFRQ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 160.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.63 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|