C11H9ClN4O4 — CID 106720668
4-(chloromethyl)-1-[(2,4-dinitrophenyl)methyl]imidazole (PubChem CID 106720668) has the molecular formula C11H9ClN4O4 and a molecular weight of 296.67 g/mol. Its IUPAC name is 4-(chloromethyl)-1-[(2,4-dinitrophenyl)methyl]imidazole.
| Compound Name | 4-(chloromethyl)-1-[(2,4-dinitrophenyl)methyl]imidazole |
|---|---|
| PubChem CID | 106720668 |
| Molecular Formula | C11H9ClN4O4 |
| Molecular Weight | 296.67 g/mol |
| Exact Mass | 296.03 |
| IUPAC Name | 4-(chloromethyl)-1-[(2,4-dinitrophenyl)methyl]imidazole |
| SMILES | O=[N+]([O-])c1ccc(Cn2cnc(CCl)c2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H9ClN4O4/c12-4-9-6-14(7-13-9)5-8-1-2-10(15(17)18)3-11(8)16(19)20/h1-3,6-7H,4-5H2 |
| InChIKey | UEOKQVAVZAHTKI-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 104.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.67 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|