C10H8ClN5O4 — CID 66223733
5-(chloromethyl)-1-[(2,4-dinitrophenyl)methyl]-1,2,4-triazole (PubChem CID 66223733) has the molecular formula C10H8ClN5O4 and a molecular weight of 297.66 g/mol. Its IUPAC name is 5-(chloromethyl)-1-[(2,4-dinitrophenyl)methyl]-1,2,4-triazole.
| Compound Name | 5-(chloromethyl)-1-[(2,4-dinitrophenyl)methyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 66223733 |
| Molecular Formula | C10H8ClN5O4 |
| Molecular Weight | 297.66 g/mol |
| Exact Mass | 297.03 |
| IUPAC Name | 5-(chloromethyl)-1-[(2,4-dinitrophenyl)methyl]-1,2,4-triazole |
| SMILES | O=[N+]([O-])c1ccc(Cn2ncnc2CCl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H8ClN5O4/c11-4-10-12-6-13-14(10)5-7-1-2-8(15(17)18)3-9(7)16(19)20/h1-3,6H,4-5H2 |
| InChIKey | JKTNNSCEONSROZ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 116.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.66 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|