C10H7ClN4O4 — CID 134125289
2-[(2-chloro-4-nitrophenyl)methyl]-1,2,4-triazine-3,5-dione (PubChem CID 134125289) has the molecular formula C10H7ClN4O4 and a molecular weight of 282.64 g/mol. Its IUPAC name is 2-[(2-chloro-4-nitrophenyl)methyl]-1,2,4-triazine-3,5-dione.
| Compound Name | 2-[(2-chloro-4-nitrophenyl)methyl]-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 134125289 |
| Molecular Formula | C10H7ClN4O4 |
| Molecular Weight | 282.64 g/mol |
| Exact Mass | 282.02 |
| IUPAC Name | 2-[(2-chloro-4-nitrophenyl)methyl]-1,2,4-triazine-3,5-dione |
| SMILES | O=c1cnn(Cc2ccc([N+](=O)[O-])cc2Cl)c(=O)[nH]1 |
| InChI | InChI=1S/C10H7ClN4O4/c11-8-3-7(15(18)19)2-1-6(8)5-14-10(17)13-9(16)4-12-14/h1-4H,5H2,(H,13,16,17) |
| InChIKey | SEBCGORSPFEDQE-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 110.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.64 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|