C11H10ClN5O4 — CID 103122023
5-(aminomethyl)-1-[(2-chloro-4-nitrophenyl)methyl]triazole-4-carboxylic acid (PubChem CID 103122023) has the molecular formula C11H10ClN5O4 and a molecular weight of 311.69 g/mol. Its IUPAC name is 5-(aminomethyl)-1-[(2-chloro-4-nitrophenyl)methyl]triazole-4-carboxylic acid.
| Compound Name | 5-(aminomethyl)-1-[(2-chloro-4-nitrophenyl)methyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 103122023 |
| Molecular Formula | C11H10ClN5O4 |
| Molecular Weight | 311.69 g/mol |
| Exact Mass | 311.04 |
| IUPAC Name | 5-(aminomethyl)-1-[(2-chloro-4-nitrophenyl)methyl]triazole-4-carboxylic acid |
| SMILES | NCc1c(C(=O)O)nnn1Cc1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C11H10ClN5O4/c12-8-3-7(17(20)21)2-1-6(8)5-16-9(4-13)10(11(18)19)14-15-16/h1-3H,4-5,13H2,(H,18,19) |
| InChIKey | DGRYMINJHADQQD-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 137.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.69 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|