C14H15ClFN3O2 — CID 102645693
1-[(2-chloro-5-fluorophenyl)methyl]-5-(2-methylpropyl)triazole-4-carboxylic acid (PubChem CID 102645693) has the molecular formula C14H15ClFN3O2 and a molecular weight of 311.74 g/mol. Its IUPAC name is 1-[(2-chloro-5-fluorophenyl)methyl]-5-(2-methylpropyl)triazole-4-carboxylic acid.
| Compound Name | 1-[(2-chloro-5-fluorophenyl)methyl]-5-(2-methylpropyl)triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 102645693 |
| Molecular Formula | C14H15ClFN3O2 |
| Molecular Weight | 311.74 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | 1-[(2-chloro-5-fluorophenyl)methyl]-5-(2-methylpropyl)triazole-4-carboxylic acid |
| SMILES | CC(C)Cc1c(C(=O)O)nnn1Cc1cc(F)ccc1Cl |
| InChI | InChI=1S/C14H15ClFN3O2/c1-8(2)5-12-13(14(20)21)17-18-19(12)7-9-6-10(16)3-4-11(9)15/h3-4,6,8H,5,7H2,1-2H3,(H,20,21) |
| InChIKey | NWCJBFBZVZZOHU-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.74 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |