C12H12ClFN4O2 — CID 103119176
5-(2-aminoethyl)-1-[(5-chloro-2-fluorophenyl)methyl]triazole-4-carboxylic acid (PubChem CID 103119176) has the molecular formula C12H12ClFN4O2 and a molecular weight of 298.70 g/mol. Its IUPAC name is 5-(2-aminoethyl)-1-[(5-chloro-2-fluorophenyl)methyl]triazole-4-carboxylic acid.
| Compound Name | 5-(2-aminoethyl)-1-[(5-chloro-2-fluorophenyl)methyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 103119176 |
| Molecular Formula | C12H12ClFN4O2 |
| Molecular Weight | 298.70 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 5-(2-aminoethyl)-1-[(5-chloro-2-fluorophenyl)methyl]triazole-4-carboxylic acid |
| SMILES | NCCc1c(C(=O)O)nnn1Cc1cc(Cl)ccc1F |
| InChI | InChI=1S/C12H12ClFN4O2/c13-8-1-2-9(14)7(5-8)6-18-10(3-4-15)11(12(19)20)16-17-18/h1-2,5H,3-4,6,15H2,(H,19,20) |
| InChIKey | GNXWFWWEFXQCTI-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.70 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |