C12H13FN4O3 — CID 103122265
5-(aminomethyl)-1-[(2-fluoro-4-methoxyphenyl)methyl]triazole-4-carboxylic acid (PubChem CID 103122265) has the molecular formula C12H13FN4O3 and a molecular weight of 280.26 g/mol. Its IUPAC name is 5-(aminomethyl)-1-[(2-fluoro-4-methoxyphenyl)methyl]triazole-4-carboxylic acid.
| Compound Name | 5-(aminomethyl)-1-[(2-fluoro-4-methoxyphenyl)methyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 103122265 |
| Molecular Formula | C12H13FN4O3 |
| Molecular Weight | 280.26 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 5-(aminomethyl)-1-[(2-fluoro-4-methoxyphenyl)methyl]triazole-4-carboxylic acid |
| SMILES | COc1ccc(Cn2nnc(C(=O)O)c2CN)c(F)c1 |
| InChI | InChI=1S/C12H13FN4O3/c1-20-8-3-2-7(9(13)4-8)6-17-10(5-14)11(12(18)19)15-16-17/h2-4H,5-6,14H2,1H3,(H,18,19) |
| InChIKey | KLOJOFFGAVBYMD-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 103.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.26 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |