C12H10BrF2N3O3 — CID 102644679
1-[(2-bromo-5-methoxyphenyl)methyl]-5-(difluoromethyl)triazole-4-carboxylic acid (PubChem CID 102644679) has the molecular formula C12H10BrF2N3O3 and a molecular weight of 362.13 g/mol. Its IUPAC name is 1-[(2-bromo-5-methoxyphenyl)methyl]-5-(difluoromethyl)triazole-4-carboxylic acid.
| Compound Name | 1-[(2-bromo-5-methoxyphenyl)methyl]-5-(difluoromethyl)triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 102644679 |
| Molecular Formula | C12H10BrF2N3O3 |
| Molecular Weight | 362.13 g/mol |
| Exact Mass | 360.99 |
| IUPAC Name | 1-[(2-bromo-5-methoxyphenyl)methyl]-5-(difluoromethyl)triazole-4-carboxylic acid |
| SMILES | COc1ccc(Br)c(Cn2nnc(C(=O)O)c2C(F)F)c1 |
| InChI | InChI=1S/C12H10BrF2N3O3/c1-21-7-2-3-8(13)6(4-7)5-18-10(11(14)15)9(12(19)20)16-17-18/h2-4,11H,5H2,1H3,(H,19,20) |
| InChIKey | GWHDUMUPJSZLBR-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.13 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |