C9H13F2N3O4 — CID 102644714
5-(difluoromethyl)-1-[2-(2-methoxyethoxy)ethyl]triazole-4-carboxylic acid (PubChem CID 102644714) has the molecular formula C9H13F2N3O4 and a molecular weight of 265.22 g/mol. Its IUPAC name is 5-(difluoromethyl)-1-[2-(2-methoxyethoxy)ethyl]triazole-4-carboxylic acid.
| Compound Name | 5-(difluoromethyl)-1-[2-(2-methoxyethoxy)ethyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 102644714 |
| Molecular Formula | C9H13F2N3O4 |
| Molecular Weight | 265.22 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | 5-(difluoromethyl)-1-[2-(2-methoxyethoxy)ethyl]triazole-4-carboxylic acid |
| SMILES | COCCOCCn1nnc(C(=O)O)c1C(F)F |
| InChI | InChI=1S/C9H13F2N3O4/c1-17-4-5-18-3-2-14-7(8(10)11)6(9(15)16)12-13-14/h8H,2-5H2,1H3,(H,15,16) |
| InChIKey | GYDXOWLKVDVPQB-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.22 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|