C9H10F5N3O3 — CID 102644529
5-(difluoromethyl)-1-[3-(2,2,2-trifluoroethoxy)propyl]triazole-4-carboxylic acid (PubChem CID 102644529) has the molecular formula C9H10F5N3O3 and a molecular weight of 303.19 g/mol. Its IUPAC name is 5-(difluoromethyl)-1-[3-(2,2,2-trifluoroethoxy)propyl]triazole-4-carboxylic acid.
| Compound Name | 5-(difluoromethyl)-1-[3-(2,2,2-trifluoroethoxy)propyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 102644529 |
| Molecular Formula | C9H10F5N3O3 |
| Molecular Weight | 303.19 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | 5-(difluoromethyl)-1-[3-(2,2,2-trifluoroethoxy)propyl]triazole-4-carboxylic acid |
| SMILES | O=C(O)c1nnn(CCCOCC(F)(F)F)c1C(F)F |
| InChI | InChI=1S/C9H10F5N3O3/c10-7(11)6-5(8(18)19)15-16-17(6)2-1-3-20-4-9(12,13)14/h7H,1-4H2,(H,18,19) |
| InChIKey | MPZAXUWAGNCQEJ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.19 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|