C7H9F2N3O3 — CID 102644503
5-(difluoromethyl)-1-(3-hydroxypropyl)triazole-4-carboxylic acid (PubChem CID 102644503) has the molecular formula C7H9F2N3O3 and a molecular weight of 221.16 g/mol. Its IUPAC name is 5-(difluoromethyl)-1-(3-hydroxypropyl)triazole-4-carboxylic acid.
| Compound Name | 5-(difluoromethyl)-1-(3-hydroxypropyl)triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 102644503 |
| Molecular Formula | C7H9F2N3O3 |
| Molecular Weight | 221.16 g/mol |
| Exact Mass | 221.06 |
| IUPAC Name | 5-(difluoromethyl)-1-(3-hydroxypropyl)triazole-4-carboxylic acid |
| SMILES | O=C(O)c1nnn(CCCO)c1C(F)F |
| InChI | InChI=1S/C7H9F2N3O3/c8-6(9)5-4(7(14)15)10-11-12(5)2-1-3-13/h6,13H,1-3H2,(H,14,15) |
| InChIKey | LLXMLZRIGADOBD-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.16 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |