C10H15N3O5 — CID 139367683
1-(6-hydroxyhexyl)triazole-4,5-dicarboxylic acid (PubChem CID 139367683) has the molecular formula C10H15N3O5 and a molecular weight of 257.25 g/mol. Its IUPAC name is 1-(6-hydroxyhexyl)triazole-4,5-dicarboxylic acid.
| Compound Name | 1-(6-hydroxyhexyl)triazole-4,5-dicarboxylic acid |
|---|---|
| PubChem CID | 139367683 |
| Molecular Formula | C10H15N3O5 |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | 1-(6-hydroxyhexyl)triazole-4,5-dicarboxylic acid |
| SMILES | O=C(O)c1nnn(CCCCCCO)c1C(=O)O |
| InChI | InChI=1S/C10H15N3O5/c14-6-4-2-1-3-5-13-8(10(17)18)7(9(15)16)11-12-13/h14H,1-6H2,(H,15,16)(H,17,18) |
| InChIKey | MTNOWLDTQWUHCO-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 125.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|