C9H15N3O4 — CID 102643264
1-(4-hydroxybutyl)-5-(methoxymethyl)triazole-4-carboxylic acid (PubChem CID 102643264) has the molecular formula C9H15N3O4 and a molecular weight of 229.24 g/mol. Its IUPAC name is 1-(4-hydroxybutyl)-5-(methoxymethyl)triazole-4-carboxylic acid.
| Compound Name | 1-(4-hydroxybutyl)-5-(methoxymethyl)triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 102643264 |
| Molecular Formula | C9H15N3O4 |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | 1-(4-hydroxybutyl)-5-(methoxymethyl)triazole-4-carboxylic acid |
| SMILES | COCc1c(C(=O)O)nnn1CCCCO |
| InChI | InChI=1S/C9H15N3O4/c1-16-6-7-8(9(14)15)10-11-12(7)4-2-3-5-13/h13H,2-6H2,1H3,(H,14,15) |
| InChIKey | BDQCCQHIIOEHEB-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 97.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|