C11H14N4O5 — CID 102643359
1-[2-(2,5-dioxopyrrolidin-1-yl)ethyl]-5-(methoxymethyl)triazole-4-carboxylic acid (PubChem CID 102643359) has the molecular formula C11H14N4O5 and a molecular weight of 282.26 g/mol. Its IUPAC name is 1-[2-(2,5-dioxopyrrolidin-1-yl)ethyl]-5-(methoxymethyl)triazole-4-carboxylic acid.
| Compound Name | 1-[2-(2,5-dioxopyrrolidin-1-yl)ethyl]-5-(methoxymethyl)triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 102643359 |
| Molecular Formula | C11H14N4O5 |
| Molecular Weight | 282.26 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 1-[2-(2,5-dioxopyrrolidin-1-yl)ethyl]-5-(methoxymethyl)triazole-4-carboxylic acid |
| SMILES | COCc1c(C(=O)O)nnn1CCN1C(=O)CCC1=O |
| InChI | InChI=1S/C11H14N4O5/c1-20-6-7-10(11(18)19)12-13-15(7)5-4-14-8(16)2-3-9(14)17/h2-6H2,1H3,(H,18,19) |
| InChIKey | OXLNMTFHKYPVSG-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 114.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.26 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|