C12H16N4O5 — CID 102645932
1-[2-(2,5-dioxopyrrolidin-1-yl)ethyl]-5-(2-methoxyethyl)triazole-4-carboxylic acid (PubChem CID 102645932) has the molecular formula C12H16N4O5 and a molecular weight of 296.28 g/mol. Its IUPAC name is 1-[2-(2,5-dioxopyrrolidin-1-yl)ethyl]-5-(2-methoxyethyl)triazole-4-carboxylic acid.
| Compound Name | 1-[2-(2,5-dioxopyrrolidin-1-yl)ethyl]-5-(2-methoxyethyl)triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 102645932 |
| Molecular Formula | C12H16N4O5 |
| Molecular Weight | 296.28 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | 1-[2-(2,5-dioxopyrrolidin-1-yl)ethyl]-5-(2-methoxyethyl)triazole-4-carboxylic acid |
| SMILES | COCCc1c(C(=O)O)nnn1CCN1C(=O)CCC1=O |
| InChI | InChI=1S/C12H16N4O5/c1-21-7-4-8-11(12(19)20)13-14-16(8)6-5-15-9(17)2-3-10(15)18/h2-7H2,1H3,(H,19,20) |
| InChIKey | KLHGIRSXEMUTIT-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 114.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.28 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|