C13H22N4O4 — CID 102645866
5-(2-methoxyethyl)-1-[2-(3-methylbutan-2-ylamino)-2-oxoethyl]triazole-4-carboxylic acid (PubChem CID 102645866) has the molecular formula C13H22N4O4 and a molecular weight of 298.34 g/mol. Its IUPAC name is 5-(2-methoxyethyl)-1-[2-(3-methylbutan-2-ylamino)-2-oxoethyl]triazole-4-carboxylic acid.
| Compound Name | 5-(2-methoxyethyl)-1-[2-(3-methylbutan-2-ylamino)-2-oxoethyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 102645866 |
| Molecular Formula | C13H22N4O4 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | 5-(2-methoxyethyl)-1-[2-(3-methylbutan-2-ylamino)-2-oxoethyl]triazole-4-carboxylic acid |
| SMILES | COCCc1c(C(=O)O)nnn1CC(=O)NC(C)C(C)C |
| InChI | InChI=1S/C13H22N4O4/c1-8(2)9(3)14-11(18)7-17-10(5-6-21-4)12(13(19)20)15-16-17/h8-9H,5-7H2,1-4H3,(H,14,18)(H,19,20) |
| InChIKey | OPYNLEXCIQYZGA-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |