C13H23N5O3 — CID 103118164
methyl 5-(2-aminoethyl)-1-[2-(3-methylbutan-2-ylamino)-2-oxoethyl]triazole-4-carboxylate (PubChem CID 103118164) has the molecular formula C13H23N5O3 and a molecular weight of 297.36 g/mol. Its IUPAC name is methyl 5-(2-aminoethyl)-1-[2-(3-methylbutan-2-ylamino)-2-oxoethyl]triazole-4-carboxylate.
| Compound Name | methyl 5-(2-aminoethyl)-1-[2-(3-methylbutan-2-ylamino)-2-oxoethyl]triazole-4-carboxylate |
|---|---|
| PubChem CID | 103118164 |
| Molecular Formula | C13H23N5O3 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.18 |
| IUPAC Name | methyl 5-(2-aminoethyl)-1-[2-(3-methylbutan-2-ylamino)-2-oxoethyl]triazole-4-carboxylate |
| SMILES | COC(=O)c1nnn(CC(=O)NC(C)C(C)C)c1CCN |
| InChI | InChI=1S/C13H23N5O3/c1-8(2)9(3)15-11(19)7-18-10(5-6-14)12(16-17-18)13(20)21-4/h8-9H,5-7,14H2,1-4H3,(H,15,19) |
| InChIKey | WJNVAKKWORDXRK-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 112.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |