C8H13FN4O2 — CID 103118704
methyl 5-(2-aminoethyl)-1-(2-fluoroethyl)triazole-4-carboxylate (PubChem CID 103118704) has the molecular formula C8H13FN4O2 and a molecular weight of 216.22 g/mol. Its IUPAC name is methyl 5-(2-aminoethyl)-1-(2-fluoroethyl)triazole-4-carboxylate.
| Compound Name | methyl 5-(2-aminoethyl)-1-(2-fluoroethyl)triazole-4-carboxylate |
|---|---|
| PubChem CID | 103118704 |
| Molecular Formula | C8H13FN4O2 |
| Molecular Weight | 216.22 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | methyl 5-(2-aminoethyl)-1-(2-fluoroethyl)triazole-4-carboxylate |
| SMILES | COC(=O)c1nnn(CCF)c1CCN |
| InChI | InChI=1S/C8H13FN4O2/c1-15-8(14)7-6(2-4-10)13(5-3-9)12-11-7/h2-5,10H2,1H3 |
| InChIKey | GITURBPOVKAEHL-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.22 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |