C12H21N5O4 — CID 103118168
methyl 5-(2-aminoethyl)-1-[2-(3-methoxypropylamino)-2-oxoethyl]triazole-4-carboxylate (PubChem CID 103118168) has the molecular formula C12H21N5O4 and a molecular weight of 299.33 g/mol. Its IUPAC name is methyl 5-(2-aminoethyl)-1-[2-(3-methoxypropylamino)-2-oxoethyl]triazole-4-carboxylate.
| Compound Name | methyl 5-(2-aminoethyl)-1-[2-(3-methoxypropylamino)-2-oxoethyl]triazole-4-carboxylate |
|---|---|
| PubChem CID | 103118168 |
| Molecular Formula | C12H21N5O4 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | methyl 5-(2-aminoethyl)-1-[2-(3-methoxypropylamino)-2-oxoethyl]triazole-4-carboxylate |
| SMILES | COCCCNC(=O)Cn1nnc(C(=O)OC)c1CCN |
| InChI | InChI=1S/C12H21N5O4/c1-20-7-3-6-14-10(18)8-17-9(4-5-13)11(15-16-17)12(19)21-2/h3-8,13H2,1-2H3,(H,14,18) |
| InChIKey | LJQQSABXJFIAFN-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 121.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|