C11H19N5O3 — CID 103118086
methyl 5-(2-aminoethyl)-1-[2-[ethyl(methyl)amino]-2-oxoethyl]triazole-4-carboxylate (PubChem CID 103118086) has the molecular formula C11H19N5O3 and a molecular weight of 269.30 g/mol. Its IUPAC name is methyl 5-(2-aminoethyl)-1-[2-[ethyl(methyl)amino]-2-oxoethyl]triazole-4-carboxylate.
| Compound Name | methyl 5-(2-aminoethyl)-1-[2-[ethyl(methyl)amino]-2-oxoethyl]triazole-4-carboxylate |
|---|---|
| PubChem CID | 103118086 |
| Molecular Formula | C11H19N5O3 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | methyl 5-(2-aminoethyl)-1-[2-[ethyl(methyl)amino]-2-oxoethyl]triazole-4-carboxylate |
| SMILES | CCN(C)C(=O)Cn1nnc(C(=O)OC)c1CCN |
| InChI | InChI=1S/C11H19N5O3/c1-4-15(2)9(17)7-16-8(5-6-12)10(13-14-16)11(18)19-3/h4-7,12H2,1-3H3 |
| InChIKey | SEDCQVNKESVGPI-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 103.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |