C12H21N5O3 — CID 103111070
ethyl 5-(aminomethyl)-1-[2-[methyl(propan-2-yl)amino]-2-oxoethyl]triazole-4-carboxylate (PubChem CID 103111070) has the molecular formula C12H21N5O3 and a molecular weight of 283.33 g/mol. Its IUPAC name is ethyl 5-(aminomethyl)-1-[2-[methyl(propan-2-yl)amino]-2-oxoethyl]triazole-4-carboxylate.
| Compound Name | ethyl 5-(aminomethyl)-1-[2-[methyl(propan-2-yl)amino]-2-oxoethyl]triazole-4-carboxylate |
|---|---|
| PubChem CID | 103111070 |
| Molecular Formula | C12H21N5O3 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | ethyl 5-(aminomethyl)-1-[2-[methyl(propan-2-yl)amino]-2-oxoethyl]triazole-4-carboxylate |
| SMILES | CCOC(=O)c1nnn(CC(=O)N(C)C(C)C)c1CN |
| InChI | InChI=1S/C12H21N5O3/c1-5-20-12(19)11-9(6-13)17(15-14-11)7-10(18)16(4)8(2)3/h8H,5-7,13H2,1-4H3 |
| InChIKey | KEOVIAITSVBWJC-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 103.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |