C10H18N4O3 — CID 103111684
ethyl 5-(aminomethyl)-1-(3-hydroxybutyl)triazole-4-carboxylate (PubChem CID 103111684) has the molecular formula C10H18N4O3 and a molecular weight of 242.28 g/mol. Its IUPAC name is ethyl 5-(aminomethyl)-1-(3-hydroxybutyl)triazole-4-carboxylate.
| Compound Name | ethyl 5-(aminomethyl)-1-(3-hydroxybutyl)triazole-4-carboxylate |
|---|---|
| PubChem CID | 103111684 |
| Molecular Formula | C10H18N4O3 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.14 |
| IUPAC Name | ethyl 5-(aminomethyl)-1-(3-hydroxybutyl)triazole-4-carboxylate |
| SMILES | CCOC(=O)c1nnn(CCC(C)O)c1CN |
| InChI | InChI=1S/C10H18N4O3/c1-3-17-10(16)9-8(6-11)14(13-12-9)5-4-7(2)15/h7,15H,3-6,11H2,1-2H3 |
| InChIKey | GMSSXRWGCYXZJR-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 103.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |