C9H13ClN4O3 — CID 103108765
ethyl 1-(3-amino-3-oxopropyl)-5-(chloromethyl)triazole-4-carboxylate (PubChem CID 103108765) has the molecular formula C9H13ClN4O3 and a molecular weight of 260.68 g/mol. Its IUPAC name is ethyl 1-(3-amino-3-oxopropyl)-5-(chloromethyl)triazole-4-carboxylate.
| Compound Name | ethyl 1-(3-amino-3-oxopropyl)-5-(chloromethyl)triazole-4-carboxylate |
|---|---|
| PubChem CID | 103108765 |
| Molecular Formula | C9H13ClN4O3 |
| Molecular Weight | 260.68 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | ethyl 1-(3-amino-3-oxopropyl)-5-(chloromethyl)triazole-4-carboxylate |
| SMILES | CCOC(=O)c1nnn(CCC(N)=O)c1CCl |
| InChI | InChI=1S/C9H13ClN4O3/c1-2-17-9(16)8-6(5-10)14(13-12-8)4-3-7(11)15/h2-5H2,1H3,(H2,11,15) |
| InChIKey | WDDMBWJXIUZXOF-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 100.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.68 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|