C10H13ClN4O5 — CID 103108731
ethyl 5-(chloromethyl)-1-[2-(methoxycarbonylamino)-2-oxoethyl]triazole-4-carboxylate (PubChem CID 103108731) has the molecular formula C10H13ClN4O5 and a molecular weight of 304.69 g/mol. Its IUPAC name is ethyl 5-(chloromethyl)-1-[2-(methoxycarbonylamino)-2-oxoethyl]triazole-4-carboxylate.
| Compound Name | ethyl 5-(chloromethyl)-1-[2-(methoxycarbonylamino)-2-oxoethyl]triazole-4-carboxylate |
|---|---|
| PubChem CID | 103108731 |
| Molecular Formula | C10H13ClN4O5 |
| Molecular Weight | 304.69 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | ethyl 5-(chloromethyl)-1-[2-(methoxycarbonylamino)-2-oxoethyl]triazole-4-carboxylate |
| SMILES | CCOC(=O)c1nnn(CC(=O)NC(=O)OC)c1CCl |
| InChI | InChI=1S/C10H13ClN4O5/c1-3-20-9(17)8-6(4-11)15(14-13-8)5-7(16)12-10(18)19-2/h3-5H2,1-2H3,(H,12,16,18) |
| InChIKey | XPEILOWJFQVYIF-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 112.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.69 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|