C12H20ClN3O4 — CID 103109469
ethyl 5-(chloromethyl)-1-(2-hydroxy-3-propan-2-yloxypropyl)triazole-4-carboxylate (PubChem CID 103109469) has the molecular formula C12H20ClN3O4 and a molecular weight of 305.76 g/mol. Its IUPAC name is ethyl 5-(chloromethyl)-1-(2-hydroxy-3-propan-2-yloxypropyl)triazole-4-carboxylate.
| Compound Name | ethyl 5-(chloromethyl)-1-(2-hydroxy-3-propan-2-yloxypropyl)triazole-4-carboxylate |
|---|---|
| PubChem CID | 103109469 |
| Molecular Formula | C12H20ClN3O4 |
| Molecular Weight | 305.76 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | ethyl 5-(chloromethyl)-1-(2-hydroxy-3-propan-2-yloxypropyl)triazole-4-carboxylate |
| SMILES | CCOC(=O)c1nnn(CC(O)COC(C)C)c1CCl |
| InChI | InChI=1S/C12H20ClN3O4/c1-4-19-12(18)11-10(5-13)16(15-14-11)6-9(17)7-20-8(2)3/h8-9,17H,4-7H2,1-3H3 |
| InChIKey | SBRYTQOGITVHMF-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.76 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|