C14H25N3O4 — CID 103113258
2-methylpropyl 1-(2-hydroxy-3-propan-2-yloxypropyl)-5-methyltriazole-4-carboxylate (PubChem CID 103113258) has the molecular formula C14H25N3O4 and a molecular weight of 299.37 g/mol. Its IUPAC name is 2-methylpropyl 1-(2-hydroxy-3-propan-2-yloxypropyl)-5-methyltriazole-4-carboxylate.
| Compound Name | 2-methylpropyl 1-(2-hydroxy-3-propan-2-yloxypropyl)-5-methyltriazole-4-carboxylate |
|---|---|
| PubChem CID | 103113258 |
| Molecular Formula | C14H25N3O4 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.18 |
| IUPAC Name | 2-methylpropyl 1-(2-hydroxy-3-propan-2-yloxypropyl)-5-methyltriazole-4-carboxylate |
| SMILES | Cc1c(C(=O)OCC(C)C)nnn1CC(O)COC(C)C |
| InChI | InChI=1S/C14H25N3O4/c1-9(2)7-21-14(19)13-11(5)17(16-15-13)6-12(18)8-20-10(3)4/h9-10,12,18H,6-8H2,1-5H3 |
| InChIKey | HXDMMTGQKRZILZ-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |