C13H21N3O5 — CID 106992969
prop-2-enyl 1-[2-hydroxy-3-(2-methoxyethoxy)propyl]-5-methyltriazole-4-carboxylate (PubChem CID 106992969) has the molecular formula C13H21N3O5 and a molecular weight of 299.33 g/mol. Its IUPAC name is prop-2-enyl 1-[2-hydroxy-3-(2-methoxyethoxy)propyl]-5-methyltriazole-4-carboxylate.
| Compound Name | prop-2-enyl 1-[2-hydroxy-3-(2-methoxyethoxy)propyl]-5-methyltriazole-4-carboxylate |
|---|---|
| PubChem CID | 106992969 |
| Molecular Formula | C13H21N3O5 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | prop-2-enyl 1-[2-hydroxy-3-(2-methoxyethoxy)propyl]-5-methyltriazole-4-carboxylate |
| SMILES | C=CCOC(=O)c1nnn(CC(O)COCCOC)c1C |
| InChI | InChI=1S/C13H21N3O5/c1-4-5-21-13(18)12-10(2)16(15-14-12)8-11(17)9-20-7-6-19-3/h4,11,17H,1,5-9H2,2-3H3 |
| InChIKey | FSBDGAFKJVECME-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 95.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|