C11H19N3O4 — CID 103112082
2-methoxyethyl 1-(3-hydroxy-2-methylpropyl)-5-methyltriazole-4-carboxylate (PubChem CID 103112082) has the molecular formula C11H19N3O4 and a molecular weight of 257.29 g/mol. Its IUPAC name is 2-methoxyethyl 1-(3-hydroxy-2-methylpropyl)-5-methyltriazole-4-carboxylate.
| Compound Name | 2-methoxyethyl 1-(3-hydroxy-2-methylpropyl)-5-methyltriazole-4-carboxylate |
|---|---|
| PubChem CID | 103112082 |
| Molecular Formula | C11H19N3O4 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | 2-methoxyethyl 1-(3-hydroxy-2-methylpropyl)-5-methyltriazole-4-carboxylate |
| SMILES | COCCOC(=O)c1nnn(CC(C)CO)c1C |
| InChI | InChI=1S/C11H19N3O4/c1-8(7-15)6-14-9(2)10(12-13-14)11(16)18-5-4-17-3/h8,15H,4-7H2,1-3H3 |
| InChIKey | JMGIPALXTPDRGZ-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|