C12H16N4O3 — CID 107530798
prop-2-enyl 5-methyl-1-[(5-oxopyrrolidin-2-yl)methyl]triazole-4-carboxylate (PubChem CID 107530798) has the molecular formula C12H16N4O3 and a molecular weight of 264.28 g/mol. Its IUPAC name is prop-2-enyl 5-methyl-1-[(5-oxopyrrolidin-2-yl)methyl]triazole-4-carboxylate.
| Compound Name | prop-2-enyl 5-methyl-1-[(5-oxopyrrolidin-2-yl)methyl]triazole-4-carboxylate |
|---|---|
| PubChem CID | 107530798 |
| Molecular Formula | C12H16N4O3 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | prop-2-enyl 5-methyl-1-[(5-oxopyrrolidin-2-yl)methyl]triazole-4-carboxylate |
| SMILES | C=CCOC(=O)c1nnn(CC2CCC(=O)N2)c1C |
| InChI | InChI=1S/C12H16N4O3/c1-3-6-19-12(18)11-8(2)16(15-14-11)7-9-4-5-10(17)13-9/h3,9H,1,4-7H2,2H3,(H,13,17) |
| InChIKey | SWHVIXILUUYURU-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|