C12H15N5O3 — CID 103114441
prop-2-enyl 1-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]-5-methyltriazole-4-carboxylate (PubChem CID 103114441) has the molecular formula C12H15N5O3 and a molecular weight of 277.28 g/mol. Its IUPAC name is prop-2-enyl 1-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]-5-methyltriazole-4-carboxylate.
| Compound Name | prop-2-enyl 1-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]-5-methyltriazole-4-carboxylate |
|---|---|
| PubChem CID | 103114441 |
| Molecular Formula | C12H15N5O3 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | prop-2-enyl 1-[(5-ethyl-1,3,4-oxadiazol-2-yl)methyl]-5-methyltriazole-4-carboxylate |
| SMILES | C=CCOC(=O)c1nnn(Cc2nnc(CC)o2)c1C |
| InChI | InChI=1S/C12H15N5O3/c1-4-6-19-12(18)11-8(3)17(16-15-11)7-10-14-13-9(5-2)20-10/h4H,1,5-7H2,2-3H3 |
| InChIKey | KGWPRXBLAZANGL-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 95.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|