C14H17N3O2S — CID 103114484
prop-2-enyl 1-[(5-ethylthiophen-2-yl)methyl]-5-methyltriazole-4-carboxylate (PubChem CID 103114484) has the molecular formula C14H17N3O2S and a molecular weight of 291.38 g/mol. Its IUPAC name is prop-2-enyl 1-[(5-ethylthiophen-2-yl)methyl]-5-methyltriazole-4-carboxylate.
| Compound Name | prop-2-enyl 1-[(5-ethylthiophen-2-yl)methyl]-5-methyltriazole-4-carboxylate |
|---|---|
| PubChem CID | 103114484 |
| Molecular Formula | C14H17N3O2S |
| Molecular Weight | 291.38 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | prop-2-enyl 1-[(5-ethylthiophen-2-yl)methyl]-5-methyltriazole-4-carboxylate |
| SMILES | C=CCOC(=O)c1nnn(Cc2ccc(CC)s2)c1C |
| InChI | InChI=1S/C14H17N3O2S/c1-4-8-19-14(18)13-10(3)17(16-15-13)9-12-7-6-11(5-2)20-12/h4,6-7H,1,5,8-9H2,2-3H3 |
| InChIKey | PQLHHBILIURMJW-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.38 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|