C15H16FN3O2 — CID 103114347
prop-2-enyl 1-[(5-fluoro-2-methylphenyl)methyl]-5-methyltriazole-4-carboxylate (PubChem CID 103114347) has the molecular formula C15H16FN3O2 and a molecular weight of 289.31 g/mol. Its IUPAC name is prop-2-enyl 1-[(5-fluoro-2-methylphenyl)methyl]-5-methyltriazole-4-carboxylate.
| Compound Name | prop-2-enyl 1-[(5-fluoro-2-methylphenyl)methyl]-5-methyltriazole-4-carboxylate |
|---|---|
| PubChem CID | 103114347 |
| Molecular Formula | C15H16FN3O2 |
| Molecular Weight | 289.31 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | prop-2-enyl 1-[(5-fluoro-2-methylphenyl)methyl]-5-methyltriazole-4-carboxylate |
| SMILES | C=CCOC(=O)c1nnn(Cc2cc(F)ccc2C)c1C |
| InChI | InChI=1S/C15H16FN3O2/c1-4-7-21-15(20)14-11(3)19(18-17-14)9-12-8-13(16)6-5-10(12)2/h4-6,8H,1,7,9H2,2-3H3 |
| InChIKey | WLRGMOIFVLENNF-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.31 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|