C12H13N3O2S — CID 103114473
prop-2-enyl 5-methyl-1-(thiophen-3-ylmethyl)triazole-4-carboxylate (PubChem CID 103114473) has the molecular formula C12H13N3O2S and a molecular weight of 263.32 g/mol. Its IUPAC name is prop-2-enyl 5-methyl-1-(thiophen-3-ylmethyl)triazole-4-carboxylate.
| Compound Name | prop-2-enyl 5-methyl-1-(thiophen-3-ylmethyl)triazole-4-carboxylate |
|---|---|
| PubChem CID | 103114473 |
| Molecular Formula | C12H13N3O2S |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | prop-2-enyl 5-methyl-1-(thiophen-3-ylmethyl)triazole-4-carboxylate |
| SMILES | C=CCOC(=O)c1nnn(Cc2ccsc2)c1C |
| InChI | InChI=1S/C12H13N3O2S/c1-3-5-17-12(16)11-9(2)15(14-13-11)7-10-4-6-18-8-10/h3-4,6,8H,1,5,7H2,2H3 |
| InChIKey | RUCSXHCDDYJFSV-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|