C14H17N5O2 — CID 103114398
prop-2-enyl 1-[(3-cyclopropylimidazol-4-yl)methyl]-5-methyltriazole-4-carboxylate (PubChem CID 103114398) has the molecular formula C14H17N5O2 and a molecular weight of 287.32 g/mol. Its IUPAC name is prop-2-enyl 1-[(3-cyclopropylimidazol-4-yl)methyl]-5-methyltriazole-4-carboxylate.
| Compound Name | prop-2-enyl 1-[(3-cyclopropylimidazol-4-yl)methyl]-5-methyltriazole-4-carboxylate |
|---|---|
| PubChem CID | 103114398 |
| Molecular Formula | C14H17N5O2 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | prop-2-enyl 1-[(3-cyclopropylimidazol-4-yl)methyl]-5-methyltriazole-4-carboxylate |
| SMILES | C=CCOC(=O)c1nnn(Cc2cncn2C2CC2)c1C |
| InChI | InChI=1S/C14H17N5O2/c1-3-6-21-14(20)13-10(2)19(17-16-13)8-12-7-15-9-18(12)11-4-5-11/h3,7,9,11H,1,4-6,8H2,2H3 |
| InChIKey | FVRQCCNCLCZFJV-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 74.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|