C13H15N5O3 — CID 103114385
prop-2-enyl 1-[(3-cyclopropyl-1,2,4-oxadiazol-5-yl)methyl]-5-methyltriazole-4-carboxylate (PubChem CID 103114385) has the molecular formula C13H15N5O3 and a molecular weight of 289.30 g/mol. Its IUPAC name is prop-2-enyl 1-[(3-cyclopropyl-1,2,4-oxadiazol-5-yl)methyl]-5-methyltriazole-4-carboxylate.
| Compound Name | prop-2-enyl 1-[(3-cyclopropyl-1,2,4-oxadiazol-5-yl)methyl]-5-methyltriazole-4-carboxylate |
|---|---|
| PubChem CID | 103114385 |
| Molecular Formula | C13H15N5O3 |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | prop-2-enyl 1-[(3-cyclopropyl-1,2,4-oxadiazol-5-yl)methyl]-5-methyltriazole-4-carboxylate |
| SMILES | C=CCOC(=O)c1nnn(Cc2nc(C3CC3)no2)c1C |
| InChI | InChI=1S/C13H15N5O3/c1-3-6-20-13(19)11-8(2)18(17-15-11)7-10-14-12(16-21-10)9-4-5-9/h3,9H,1,4-7H2,2H3 |
| InChIKey | UPONIKWXECUSIV-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 95.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|