C14H23N3O4 — CID 103107226
ethyl 5-cyclopropyl-1-(2-hydroxy-3-propan-2-yloxypropyl)triazole-4-carboxylate (PubChem CID 103107226) has the molecular formula C14H23N3O4 and a molecular weight of 297.36 g/mol. Its IUPAC name is ethyl 5-cyclopropyl-1-(2-hydroxy-3-propan-2-yloxypropyl)triazole-4-carboxylate.
| Compound Name | ethyl 5-cyclopropyl-1-(2-hydroxy-3-propan-2-yloxypropyl)triazole-4-carboxylate |
|---|---|
| PubChem CID | 103107226 |
| Molecular Formula | C14H23N3O4 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | ethyl 5-cyclopropyl-1-(2-hydroxy-3-propan-2-yloxypropyl)triazole-4-carboxylate |
| SMILES | CCOC(=O)c1nnn(CC(O)COC(C)C)c1C1CC1 |
| InChI | InChI=1S/C14H23N3O4/c1-4-20-14(19)12-13(10-5-6-10)17(16-15-12)7-11(18)8-21-9(2)3/h9-11,18H,4-8H2,1-3H3 |
| InChIKey | JZSSFOVMEMHNBZ-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |