C16H21N3O2 — CID 103112869
2-methylpropyl 5-methyl-1-[(2-methylphenyl)methyl]triazole-4-carboxylate (PubChem CID 103112869) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is 2-methylpropyl 5-methyl-1-[(2-methylphenyl)methyl]triazole-4-carboxylate.
| Compound Name | 2-methylpropyl 5-methyl-1-[(2-methylphenyl)methyl]triazole-4-carboxylate |
|---|---|
| PubChem CID | 103112869 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | 2-methylpropyl 5-methyl-1-[(2-methylphenyl)methyl]triazole-4-carboxylate |
| SMILES | Cc1ccccc1Cn1nnc(C(=O)OCC(C)C)c1C |
| InChI | InChI=1S/C16H21N3O2/c1-11(2)10-21-16(20)15-13(4)19(18-17-15)9-14-8-6-5-7-12(14)3/h5-8,11H,9-10H2,1-4H3 |
| InChIKey | LJMARCHALPCUPJ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |