C24H28N6O8 — CID 4232507
diethyl 1-[[2-[[4,5-bis(ethoxycarbonyl)triazol-1-yl]methyl]phenyl]methyl]triazole-4,5-dicarboxylate (PubChem CID 4232507) has the molecular formula C24H28N6O8 and a molecular weight of 528.52 g/mol. Its IUPAC name is diethyl 1-[[2-[[4,5-bis(ethoxycarbonyl)triazol-1-yl]methyl]phenyl]methyl]triazole-4,5-dicarboxylate.
| Compound Name | diethyl 1-[[2-[[4,5-bis(ethoxycarbonyl)triazol-1-yl]methyl]phenyl]methyl]triazole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 4232507 |
| Molecular Formula | C24H28N6O8 |
| Molecular Weight | 528.52 g/mol |
| Exact Mass | 528.20 |
| IUPAC Name | diethyl 1-[[2-[[4,5-bis(ethoxycarbonyl)triazol-1-yl]methyl]phenyl]methyl]triazole-4,5-dicarboxylate |
| SMILES | CCOC(=O)c1nnn(Cc2ccccc2Cn2nnc(C(=O)OCC)c2C(=O)OCC)c1C(=O)OCC |
| InChI | InChI=1S/C24H28N6O8/c1-5-35-21(31)17-19(23(33)37-7-3)29(27-25-17)13-15-11-9-10-12-16(15)14-30-20(24(34)38-8-4)18(26-28-30)22(32)36-6-2/h9-12H,5-8,13-14H2,1-4H3 |
| InChIKey | YTXBREZCNXEJKE-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 166.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.52 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|