C16H17Cl2N3O5 — CID 13414023
diethyl 1-[[4-chloro-2-(chloromethyl)phenoxy]methyl]triazole-4,5-dicarboxylate (PubChem CID 13414023) has the molecular formula C16H17Cl2N3O5 and a molecular weight of 402.23 g/mol. Its IUPAC name is diethyl 1-[[4-chloro-2-(chloromethyl)phenoxy]methyl]triazole-4,5-dicarboxylate.
| Compound Name | diethyl 1-[[4-chloro-2-(chloromethyl)phenoxy]methyl]triazole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 13414023 |
| Molecular Formula | C16H17Cl2N3O5 |
| Molecular Weight | 402.23 g/mol |
| Exact Mass | 401.05 |
| IUPAC Name | diethyl 1-[[4-chloro-2-(chloromethyl)phenoxy]methyl]triazole-4,5-dicarboxylate |
| SMILES | CCOC(=O)c1nnn(COc2ccc(Cl)cc2CCl)c1C(=O)OCC |
| InChI | InChI=1S/C16H17Cl2N3O5/c1-3-24-15(22)13-14(16(23)25-4-2)21(20-19-13)9-26-12-6-5-11(18)7-10(12)8-17/h5-7H,3-4,8-9H2,1-2H3 |
| InChIKey | UFFGULFANCEMFS-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 92.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.23 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|