C14H14ClN3O4 — CID 7184900
diethyl 1-(4-chlorophenyl)triazole-4,5-dicarboxylate (PubChem CID 7184900) has the molecular formula C14H14ClN3O4 and a molecular weight of 323.74 g/mol. Its IUPAC name is diethyl 1-(4-chlorophenyl)triazole-4,5-dicarboxylate.
| Compound Name | diethyl 1-(4-chlorophenyl)triazole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 7184900 |
| Molecular Formula | C14H14ClN3O4 |
| Molecular Weight | 323.74 g/mol |
| Exact Mass | 323.07 |
| IUPAC Name | diethyl 1-(4-chlorophenyl)triazole-4,5-dicarboxylate |
| SMILES | CCOC(=O)c1nnn(-c2ccc(Cl)cc2)c1C(=O)OCC |
| InChI | InChI=1S/C14H14ClN3O4/c1-3-21-13(19)11-12(14(20)22-4-2)18(17-16-11)10-7-5-9(15)6-8-10/h5-8H,3-4H2,1-2H3 |
| InChIKey | RSANPVJDODXLHL-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 83.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.74 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |