C12H13N5O3 — CID 82195352
ethyl 5-amino-1-(4-carbamoylphenyl)triazole-4-carboxylate (PubChem CID 82195352) has the molecular formula C12H13N5O3 and a molecular weight of 275.27 g/mol. Its IUPAC name is ethyl 5-amino-1-(4-carbamoylphenyl)triazole-4-carboxylate.
| Compound Name | ethyl 5-amino-1-(4-carbamoylphenyl)triazole-4-carboxylate |
|---|---|
| PubChem CID | 82195352 |
| Molecular Formula | C12H13N5O3 |
| Molecular Weight | 275.27 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | ethyl 5-amino-1-(4-carbamoylphenyl)triazole-4-carboxylate |
| SMILES | CCOC(=O)c1nnn(-c2ccc(C(N)=O)cc2)c1N |
| InChI | InChI=1S/C12H13N5O3/c1-2-20-12(19)9-10(13)17(16-15-9)8-5-3-7(4-6-8)11(14)18/h3-6H,2,13H2,1H3,(H2,14,18) |
| InChIKey | ACDLBQZQBZRXJC-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 126.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.27 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |