C13H14N4O3 — CID 82365389
ethyl 5-amino-1-(4-carbamoylphenyl)pyrazole-4-carboxylate (PubChem CID 82365389) has the molecular formula C13H14N4O3 and a molecular weight of 274.28 g/mol. Its IUPAC name is ethyl 5-amino-1-(4-carbamoylphenyl)pyrazole-4-carboxylate.
| Compound Name | ethyl 5-amino-1-(4-carbamoylphenyl)pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 82365389 |
| Molecular Formula | C13H14N4O3 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | ethyl 5-amino-1-(4-carbamoylphenyl)pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(-c2ccc(C(N)=O)cc2)c1N |
| InChI | InChI=1S/C13H14N4O3/c1-2-20-13(19)10-7-16-17(11(10)14)9-5-3-8(4-6-9)12(15)18/h3-7H,2,14H2,1H3,(H2,15,18) |
| InChIKey | RNEJYCFDOURMEA-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 113.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |